CAS 1448312-00-2 appears in our catalog under these names: 2-Bromo-5-carboxyphenylboronic acid, 97%, 2-Bromo-5-carboxyphenylboronic acid, ≥95%, ≥95%, 3-Borono-4-bromobenzoic acid, 98%, 3-Borono-4-bromobenzoic acid. Offered by: Combi-blocks, Chemat, AmBeed, Fluorochem. Available pack sizes: 1g, 5g.
3-borono-4-bromobenzoic acid (CAS 1448312-00-2) is a chemical compound with the molecular formula C7H6BBrO4 and a molecular weight of 244.84 g/mol. IUPAC name: 3-borono-4-bromobenzoic acid. InChIKey: JUJQJPLPACWWKJ-UHFFFAOYSA-N.
| Molecular formula | C7H6BBrO4 |
|---|---|
| Molecular weight | 244.84 g/mol |
| IUPAC name | 3-borono-4-bromobenzoic acid |
| InChIKey | JUJQJPLPACWWKJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)O)Br)(O)O |
Computed by PubChem (NCBI)