cas: 1622216-98-1 — see every product listed under this CAS number, including other names
(6-CHLORO-5-(METHOXYCARBONYL)PYRIDIN-3-YL)BORONIC ACID PINACOL ESTER, 95% (CAS 1622216-98-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F500531-100MG |
| cas | 1622216-98-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 763.29 Pln | |
| Fluorochem | 250mg | 1445.34 Pln | |
| Fluorochem | 1g | 4069.42 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxylate (CAS 1622216-98-1) is a chemical compound with the molecular formula C13H17BClNO4 and a molecular weight of 297.54 g/mol. IUPAC name: methyl 2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxylate. InChIKey: UVEFLSVJRDSQOO-UHFFFAOYSA-N.
| Molecular formula | C13H17BClNO4 |
|---|---|
| Molecular weight | 297.54 g/mol |
| IUPAC name | methyl 2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxylate |
| InChIKey | UVEFLSVJRDSQOO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)Cl)C(=O)OC |
Computed by PubChem (NCBI)