CAS 2377607-14-0 is the registry number for 5-Chloro-2-methyl-3-nitrophenylboronic acid, pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-(5-chloro-2-methyl-3-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2377607-14-0) is a chemical compound with the molecular formula C13H17BClNO4 and a molecular weight of 297.54 g/mol. IUPAC name: 2-(5-chloro-2-methyl-3-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: DTVZLIQBKIVYAG-UHFFFAOYSA-N.
| Molecular formula | C13H17BClNO4 |
|---|---|
| Molecular weight | 297.54 g/mol |
| IUPAC name | 2-(5-chloro-2-methyl-3-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | DTVZLIQBKIVYAG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2C)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)