CAS 1622217-33-7 is the registry number for Methyl 6-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Methyl 6-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxylate (CAS 1622217-33-7) is a chemical compound with the molecular formula C13H17BClNO4 and a molecular weight of 297.54 g/mol. IUPAC name: methyl 6-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxylate. InChIKey: BHTKPOYWAGYVLG-UHFFFAOYSA-N.
| Molecular formula | C13H17BClNO4 |
|---|---|
| Molecular weight | 297.54 g/mol |
| IUPAC name | methyl 6-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxylate |
| InChIKey | BHTKPOYWAGYVLG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2Cl)C(=O)OC |
Computed by PubChem (NCBI)