cas: 1072946-50-9 — see every product listed under this CAS number, including other names
(6-Chloro-2-methoxypyridin-3-yl)boronic acid, 97% (CAS 1072946-50-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210014-1G |
| cas | 1072946-50-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 419.66 Pln | |
| Fluorochem | 10g | 784.12 Pln | |
| Fluorochem | 100g | 5579.30 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(6-chloro-2-methoxy-3-pyridinyl)boronic acid (CAS 1072946-50-9) is a chemical compound with the molecular formula C6H7BClNO3 and a molecular weight of 187.39 g/mol. IUPAC name: (6-chloro-2-methoxy-3-pyridinyl)boronic acid. InChIKey: QMTFZVCHSRMZJW-UHFFFAOYSA-N.
| Molecular formula | C6H7BClNO3 |
|---|---|
| Molecular weight | 187.39 g/mol |
| IUPAC name | (6-chloro-2-methoxy-3-pyridinyl)boronic acid |
| InChIKey | QMTFZVCHSRMZJW-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)Cl)OC)(O)O |
Computed by PubChem (NCBI)