CAS 1072946-50-9 appears in our catalog under these names: 6-Chloro-2-methoxypyridine-3-boronic acid, 96%, 6-Chloro-2-methoxypyridine-3-boronic Acid, 6–Chloro–2–methoxypyridine–3–boronic acid(contains varying amounts of Anhydride), (6-Chloro-2-methoxypyridin-3-yl)boronic acid, 97%, 97%, (6-Chloro-2-methoxypyridin-3-yl)boronic acid, 97%. Offered by: Combi-blocks, TRC, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 100g, 1g, 250mg, 50mg, 100mg.
(6-chloro-2-methoxy-3-pyridinyl)boronic acid (CAS 1072946-50-9) is a chemical compound with the molecular formula C6H7BClNO3 and a molecular weight of 187.39 g/mol. IUPAC name: (6-chloro-2-methoxy-3-pyridinyl)boronic acid. InChIKey: QMTFZVCHSRMZJW-UHFFFAOYSA-N.
| Molecular formula | C6H7BClNO3 |
|---|---|
| Molecular weight | 187.39 g/mol |
| IUPAC name | (6-chloro-2-methoxy-3-pyridinyl)boronic acid |
| InChIKey | QMTFZVCHSRMZJW-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)Cl)OC)(O)O |
Computed by PubChem (NCBI)