CAS 957060-88-7 appears in our catalog under these names: 3-Chloro-2-methoxypyridine-4-boronic acid, 97%, 2-Chloro-3-methoxypyridine-4-boronic acid, 97%, 3-Chloro-2-methoxypyridine-4-boronic acid, 95%, (3-Chloro-2-methoxypyridin-4-yl)boronic acid 98%, 3-Chloro-2-methoxypyridine-4-boronic acid, 98%, 98%. Offered by: Combi-blocks, Thermo Scientific (Acros), Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 25g, 250MG, 100mg, 500mg.
(3-chloro-2-methoxy-4-pyridinyl)boronic acid (CAS 957060-88-7) is a chemical compound with the molecular formula C6H7BClNO3 and a molecular weight of 187.39 g/mol. IUPAC name: (3-chloro-2-methoxy-4-pyridinyl)boronic acid. InChIKey: YQNAXOGPSUVHNU-UHFFFAOYSA-N.
| Molecular formula | C6H7BClNO3 |
|---|---|
| Molecular weight | 187.39 g/mol |
| IUPAC name | (3-chloro-2-methoxy-4-pyridinyl)boronic acid |
| InChIKey | YQNAXOGPSUVHNU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=NC=C1)OC)Cl)(O)O |
Computed by PubChem (NCBI)