cas: 1451392-07-6 — see every product listed under this CAS number, including other names
(6-Fluoro-5-methoxypyridin-3-yl)boronic acid, 95% (CAS 1451392-07-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F694019-100MG |
| cas | 1451392-07-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 419.66 Pln | |
| Fluorochem | 250mg | 581.06 Pln | |
| Fluorochem | 1g | 1106.92 Pln | |
| Fluorochem | 5g | 4069.42 Pln | |
| Fluorochem | 10g | 6875.72 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(6-fluoro-5-methoxy-3-pyridinyl)boronic acid (CAS 1451392-07-6) is a chemical compound with the molecular formula C6H7BFNO3 and a molecular weight of 170.94 g/mol. IUPAC name: (6-fluoro-5-methoxy-3-pyridinyl)boronic acid. InChIKey: LOTUGWODSACCQG-UHFFFAOYSA-N.
| Molecular formula | C6H7BFNO3 |
|---|---|
| Molecular weight | 170.94 g/mol |
| IUPAC name | (6-fluoro-5-methoxy-3-pyridinyl)boronic acid |
| InChIKey | LOTUGWODSACCQG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)F)OC)(O)O |
Computed by PubChem (NCBI)