CAS 1572398-58-3 appears in our catalog under these names: (8-Fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)boronic acid, 98+%, 98+%, (8-Fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)boronic acid, 98+%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)boronic acid (CAS 1572398-58-3) is a chemical compound with the molecular formula C8H8BFN2O2 and a molecular weight of 193.97 g/mol. IUPAC name: (8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)boronic acid. InChIKey: RSGFFMRTZYZAEA-UHFFFAOYSA-N.
| Molecular formula | C8H8BFN2O2 |
|---|---|
| Molecular weight | 193.97 g/mol |
| IUPAC name | (8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)boronic acid |
| InChIKey | RSGFFMRTZYZAEA-UHFFFAOYSA-N |
| SMILES | B(C1=CN2C=C(N=C2C(=C1)F)C)(O)O |
Computed by PubChem (NCBI)