Products 1572398-58-3

CAS 1572398-58-3 is the registry number for (8-Fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)boronic acid, 98+%, 98+%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)boronic acid (CAS 1572398-58-3) is a chemical compound with the molecular formula C8H8BFN2O2 and a molecular weight of 193.97 g/mol. IUPAC name: (8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)boronic acid. InChIKey: RSGFFMRTZYZAEA-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8BFN2O2
Molecular weight193.97 g/mol
IUPAC name(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)boronic acid
InChIKeyRSGFFMRTZYZAEA-UHFFFAOYSA-N
SMILESB(C1=CN2C=C(N=C2C(=C1)F)C)(O)O

Computed by PubChem (NCBI)