CAS 2096331-06-3 appears in our catalog under these names: 5-Fluoro-1-methyl-1h-indazole-6-boronic acid, 96%, 5-Fluoro-1-methyl-1H-indazol-6-yl-6-boronic Acid, 5-Fluoro-1-methyl-1H-indazole-6-boronic acid, 97%, 97%, 5-FLUORO-1-METHYL-1H-INDAZOL-6-YL-6-BORONIC ACID, 97%. Offered by: Combi-blocks, TRC, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 50mg.
(5-fluoro-1-methylindazol-6-yl)boronic acid (CAS 2096331-06-3) is a chemical compound with the molecular formula C8H8BFN2O2 and a molecular weight of 193.97 g/mol. IUPAC name: (5-fluoro-1-methylindazol-6-yl)boronic acid. InChIKey: HUXIINILKOWIAC-UHFFFAOYSA-N.
| Molecular formula | C8H8BFN2O2 |
|---|---|
| Molecular weight | 193.97 g/mol |
| IUPAC name | (5-fluoro-1-methylindazol-6-yl)boronic acid |
| InChIKey | HUXIINILKOWIAC-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1F)C=NN2C)(O)O |
Computed by PubChem (NCBI)