(9H-Fluoren-9-yl)methyl (2-(2-(2-aminoethoxy)ethoxy)ethyl)carbamate hydrochloride, 95%, 95%
cas: 868599-73-9 — see every product listed under this CAS number, including other names
(9H-Fluoren-9-yl)methyl (2-(2-(2-aminoethoxy)ethoxy)ethyl)carbamate hydrochloride, 95%, 95% (CAS 868599-73-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119EPL-250mg |
| cas | 868599-73-9 |
| size | 250mg |
| availability | 50g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 626.00 Pln | |
| Chemat | 25g | 1994.00 Pln | |
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 10g | 1029.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
9H-fluoren-9-ylmethyl N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]carbamate;hydrochloride (CAS 868599-73-9) is a chemical compound with the molecular formula C21H27ClN2O4 and a molecular weight of 406.9 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]carbamate;hydrochloride. InChIKey: AEKDFMRQTBNGKL-UHFFFAOYSA-N.
| Molecular formula | C21H27ClN2O4 |
|---|---|
| Molecular weight | 406.9 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]carbamate;hydrochloride |
| InChIKey | AEKDFMRQTBNGKL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCCN.Cl |
Computed by PubChem (NCBI)
Synonyms:
1-(9-Fluorenylmethyloxycarbonyl-amino)-3,6-dioxa-8-octaneamine hydrochloride, Fmoc-DOOA*HCl, Fmoc-NH-PEG2-C2-NH2, Fmoc-DOOA HCl, FmocNH-PEG2-CH2CH2NH2 HCl, Fmoc-1-amino-3,6-dioxa-8-octanamine hydrochloride, 1-(9-Fluorenylmethyloxycarbonyl-amino)-3,6-dioxa-8-octaneamine, HCl, orb3176697, AEKDFMRQTBNGKL-UHFFFAOYSA-N, FMOC-N-AMIDO-PEG-AMINE HCL