cas: 868599-73-9 — see every product listed under this CAS number, including other names
Fmoc-DOOA HCl 95% (CAS 868599-73-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1483994-250mg |
| cas | 868599-73-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 370.38 Pln | |
| Ambeed | 5g | 932.19 Pln | |
| Ambeed | 25g | 3107.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1483994 |
9H-fluoren-9-ylmethyl N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]carbamate;hydrochloride (CAS 868599-73-9) is a chemical compound with the molecular formula C21H27ClN2O4 and a molecular weight of 406.9 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]carbamate;hydrochloride. InChIKey: AEKDFMRQTBNGKL-UHFFFAOYSA-N.
| Molecular formula | C21H27ClN2O4 |
|---|---|
| Molecular weight | 406.9 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]carbamate;hydrochloride |
| InChIKey | AEKDFMRQTBNGKL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCCN.Cl |
Computed by PubChem (NCBI)