CAS 868599-73-9 appears in our catalog under these names: 1-(9-Fluorenylmethyloxycarbonyl-amino)-3,6-dioxa-8-octaneamine hydrochloride, 98%, Fmoc-DOOA*HCl, Fmoc-DOOA HCl 95%, (9H-Fluoren-9-yl)methyl (2-(2-(2-aminoethoxy)ethoxy)ethyl)carbamate hydrochloride, 95%, 95%, Fmoc-NH-PEG2-C2-NH2 (hydrochloride), 99.13%. Offered by: Combi-blocks, Iris Biotech, Ambeed, Chemat, MedChemExpress. Available pack sizes: 250mg, 5g, 10g, 25g, 1g, 100mg, 500 mg, 25 g.
9H-fluoren-9-ylmethyl N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]carbamate;hydrochloride (CAS 868599-73-9) is a chemical compound with the molecular formula C21H27ClN2O4 and a molecular weight of 406.9 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]carbamate;hydrochloride. InChIKey: AEKDFMRQTBNGKL-UHFFFAOYSA-N.
| Molecular formula | C21H27ClN2O4 |
|---|---|
| Molecular weight | 406.9 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]carbamate;hydrochloride |
| InChIKey | AEKDFMRQTBNGKL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCCN.Cl |
Computed by PubChem (NCBI)