cas: 205688-13-7 — see every product listed under this CAS number, including other names
(9H-Fluoren-9-yl)methyl (4-aminophenyl)carbamate, 97%, 97% (CAS 205688-13-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113A0N-100mg |
| cas | 205688-13-7 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 477.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
9H-fluoren-9-ylmethyl N-(4-aminophenyl)carbamate (CAS 205688-13-7) is a chemical compound with the molecular formula C21H18N2O2 and a molecular weight of 330.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(4-aminophenyl)carbamate. InChIKey: ALQJHOXOLDYSLS-UHFFFAOYSA-N.
| Molecular formula | C21H18N2O2 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(4-aminophenyl)carbamate |
| InChIKey | ALQJHOXOLDYSLS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC=C(C=C4)N |
Computed by PubChem (NCBI)