CAS 68375-17-7 is the registry number for 2-(2,3,4,9-Tetrahydro-1H-carbazol-6-ylmethyl)-1H-isoindole-1,3(2H)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
2-(6,7,8,9-tetrahydro-5H-carbazol-3-ylmethyl)isoindole-1,3-dione (CAS 68375-17-7) is a chemical compound with the molecular formula C21H18N2O2 and a molecular weight of 330.4 g/mol. IUPAC name: 2-(6,7,8,9-tetrahydro-5H-carbazol-3-ylmethyl)isoindole-1,3-dione. InChIKey: PCBFCGKPOYZRHU-UHFFFAOYSA-N.
| Molecular formula | C21H18N2O2 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 2-(6,7,8,9-tetrahydro-5H-carbazol-3-ylmethyl)isoindole-1,3-dione |
| InChIKey | PCBFCGKPOYZRHU-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(N2)C=CC(=C3)CN4C(=O)C5=CC=CC=C5C4=O |
Computed by PubChem (NCBI)