CAS 205688-13-7 appears in our catalog under these names: (9H-Fluoren-9-yl)methyl 4-aminophenylcarbamate, 95%, (9H-Fluoren-9-yl)methyl (4-aminophenyl)carbamate, 97%, 97%, (9H-Fluoren-9-yl)methyl (4-aminophenyl)carbamate, 96%, (4-aminophenyl)-Fmoc-amine, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 5g.
9H-fluoren-9-ylmethyl N-(4-aminophenyl)carbamate (CAS 205688-13-7) is a chemical compound with the molecular formula C21H18N2O2 and a molecular weight of 330.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(4-aminophenyl)carbamate. InChIKey: ALQJHOXOLDYSLS-UHFFFAOYSA-N.
| Molecular formula | C21H18N2O2 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(4-aminophenyl)carbamate |
| InChIKey | ALQJHOXOLDYSLS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC=C(C=C4)N |
Computed by PubChem (NCBI)