CAS 5490-92-6 appears in our catalog under these names: 9H–xanthen–9–ylmethanol, 9H-Xanthene-9-methanol, (9H-Xanthen-9-yl)methanol, 95%, 95%, (9H-xanthen-9-yl)methanol, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 50mg, 0,5g.
9H-xanthen-9-ylmethanol (CAS 5490-92-6) is a chemical compound with the molecular formula C14H12O2 and a molecular weight of 212.24 g/mol. IUPAC name: 9H-xanthen-9-ylmethanol. InChIKey: XODHGYGQZLHGJZ-UHFFFAOYSA-N.
| Molecular formula | C14H12O2 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 9H-xanthen-9-ylmethanol |
| InChIKey | XODHGYGQZLHGJZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C3O2)CO |
Computed by PubChem (NCBI)