CAS 1228594-41-9 is the registry number for 2'-(Hydroxymethyl)-[1,1'-biphenyl]-4-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-[2-(hydroxymethyl)phenyl]benzaldehyde (CAS 1228594-41-9) is a chemical compound with the molecular formula C14H12O2 and a molecular weight of 212.24 g/mol. IUPAC name: 4-[2-(hydroxymethyl)phenyl]benzaldehyde. InChIKey: UBQIRFAQMBAOQO-UHFFFAOYSA-N.
| Molecular formula | C14H12O2 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 4-[2-(hydroxymethyl)phenyl]benzaldehyde |
| InChIKey | UBQIRFAQMBAOQO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CO)C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)