Products 16605-99-5
CAS 16605-99-5 appears in our catalog under these names: Methyl biphenyl-2-carboxylate, 97%, Methyl–biphenyl–2–carboxylate, Methyl [1,1'-biphenyl]-2-carboxylate 98%, [1,1'-Biphenyl]-2-carboxylic acid, methyl ester, 98%, 98%, Methyl biphenyl-2-carboxylate, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 100mg, 250mg, 25g, 100g.
Methyl 2-phenylbenzoate (CAS 16605-99-5) is a chemical compound with the molecular formula C14H12O2 and a molecular weight of 212.24 g/mol. IUPAC name: methyl 2-phenylbenzoate. InChIKey: WNAFVJVEADYQAI-UHFFFAOYSA-N.
| Molecular formula | C14H12O2 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | methyl 2-phenylbenzoate |
| InChIKey | WNAFVJVEADYQAI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC=C1C2=CC=CC=C2 |
Computed by PubChem (NCBI)