cas: 850568-49-9 — see every product listed under this CAS number, including other names
(E)-(4-(3-ethoxy-3-oxoprop-1-en-1-yl)phenyl)boronic acid 98% (CAS 850568-49-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1219782-1g |
| cas | 850568-49-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 1037.88 Pln | |
| Ambeed | 25g | 3791.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1219782 |
[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]boronic acid (CAS 850568-49-9) is a chemical compound with the molecular formula C11H13BO4 and a molecular weight of 220.03 g/mol. IUPAC name: [4-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]boronic acid. InChIKey: OVNZUEJWYIMMSW-VMPITWQZSA-N.
| Molecular formula | C11H13BO4 |
|---|---|
| Molecular weight | 220.03 g/mol |
| IUPAC name | [4-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]boronic acid |
| InChIKey | OVNZUEJWYIMMSW-VMPITWQZSA-N |
| SMILES | B(C1=CC=C(C=C1)/C=C/C(=O)OCC)(O)O |
Computed by PubChem (NCBI)