CAS 1628507-89-0 appears in our catalog under these names: 1-[4-(Dihydroxyboranyl)-3-methylphenyl]cyclopropane-1-carboxylic acid, 96%, 1-(4-Borono-3-methylphenyl)cyclopropanecarboxylic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
1-(4-borono-3-methylphenyl)cyclopropane-1-carboxylic acid (CAS 1628507-89-0) is a chemical compound with the molecular formula C11H13BO4 and a molecular weight of 220.03 g/mol. IUPAC name: 1-(4-borono-3-methylphenyl)cyclopropane-1-carboxylic acid. InChIKey: GNYDSCKYOPJKTK-UHFFFAOYSA-N.
| Molecular formula | C11H13BO4 |
|---|---|
| Molecular weight | 220.03 g/mol |
| IUPAC name | 1-(4-borono-3-methylphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | GNYDSCKYOPJKTK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C2(CC2)C(=O)O)C)(O)O |
Computed by PubChem (NCBI)