CAS 850568-49-9 appears in our catalog under these names: 4-(E-3-Ethoxy-3-oxo-1-propen-1-yl)phenylboronic acid, 98%, 4–(E–3–Ethoxy–3–oxo–1–propen–1–yl)phenylboronic acid, (E)-(4-(3-ethoxy-3-oxoprop-1-en-1-yl)phenyl)boronic acid, 98%, 98%, (E)-(4-(3-Ethoxy-3-oxoprop-1-en-1-yl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 25g, 1g.
[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]boronic acid (CAS 850568-49-9) is a chemical compound with the molecular formula C11H13BO4 and a molecular weight of 220.03 g/mol. IUPAC name: [4-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]boronic acid. InChIKey: OVNZUEJWYIMMSW-VMPITWQZSA-N.
| Molecular formula | C11H13BO4 |
|---|---|
| Molecular weight | 220.03 g/mol |
| IUPAC name | [4-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]boronic acid |
| InChIKey | OVNZUEJWYIMMSW-VMPITWQZSA-N |
| SMILES | B(C1=CC=C(C=C1)/C=C/C(=O)OCC)(O)O |
Computed by PubChem (NCBI)