cas: 1073354-58-1 — see every product listed under this CAS number, including other names
(E)-2-(3,5-Difluorostyryl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97% (CAS 1073354-58-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F336614-100MG |
| cas | 1073354-58-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 138.51 Pln | |
| Fluorochem | 250mg | 258.26 Pln | |
| Fluorochem | 500mg | 456.11 Pln | |
| Fluorochem | 1g | 846.59 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-[(E)-2-(3,5-difluorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1073354-58-1) is a chemical compound with the molecular formula C14H17BF2O2 and a molecular weight of 266.09 g/mol. IUPAC name: 2-[(E)-2-(3,5-difluorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: LKRHAXIALBYDDQ-AATRIKPKSA-N.
| Molecular formula | C14H17BF2O2 |
|---|---|
| Molecular weight | 266.09 g/mol |
| IUPAC name | 2-[(E)-2-(3,5-difluorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | LKRHAXIALBYDDQ-AATRIKPKSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)