cas: 1073354-58-1 — see every product listed under this CAS number, including other names
Trans-2-(3,5-difluorophenyl)vinyl boronic acid pinacol ester, 96%, 96% (CAS 1073354-58-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118WHO-100mg |
| cas | 1073354-58-1 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 650.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-[(E)-2-(3,5-difluorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1073354-58-1) is a chemical compound with the molecular formula C14H17BF2O2 and a molecular weight of 266.09 g/mol. IUPAC name: 2-[(E)-2-(3,5-difluorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: LKRHAXIALBYDDQ-AATRIKPKSA-N.
| Molecular formula | C14H17BF2O2 |
|---|---|
| Molecular weight | 266.09 g/mol |
| IUPAC name | 2-[(E)-2-(3,5-difluorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | LKRHAXIALBYDDQ-AATRIKPKSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)