(E)-2-(3-Chloroprop-1-en-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95%
cas: 153724-93-7 — see every product listed under this CAS number, including other names
(E)-2-(3-Chloroprop-1-en-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95% (CAS 153724-93-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ACCM-100mg |
| cas | 153724-93-7 |
| size | 100mg |
| availability | 50g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 318.80 Pln | |
| Chemat | 5g | 846.80 Pln | |
| Chemat | 25g | 3962.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[(E)-3-chloroprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 153724-93-7) is a chemical compound with the molecular formula C9H16BClO2 and a molecular weight of 202.49 g/mol. IUPAC name: 2-[(E)-3-chloroprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HLBDNUSUVDDICF-AATRIKPKSA-N.
| Molecular formula | C9H16BClO2 |
|---|---|
| Molecular weight | 202.49 g/mol |
| IUPAC name | 2-[(E)-3-chloroprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HLBDNUSUVDDICF-AATRIKPKSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/CCl |
Computed by PubChem (NCBI)
Synonyms:
2-(3-Chloroprop-1-en-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, (E)-2-(3-chloroprop-1-en-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, E-2-Chloromethylvinylboronic acid pinacol ester, trans-2-Chloromethylvinylboronic acid pinacol ester, 2-[(E)-3-chloroprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-[(1e)-3-chloroprop-1-en-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, C9H16BClO2, HLBDNUSUVDDICF-AATRIKPKSA-N, (E)-2-(3-chloroprop-1-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, (E)-2-(3-Chloro-1-propenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane