cas: 153724-93-7 — see every product listed under this CAS number, including other names
trans-2-Chloromethylvinylboronic acid pinacol ester, ≥97-<99% (CAS 153724-93-7) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC46-97-99-25g |
| cas | 153724-93-7 |
| size | 25g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 25g | 6943.20 Pln | |
| Hoffman Fine Chemicals | 50g | 10924.32 Pln | |
| Hoffman Fine Chemicals | 100g | 17291.56 Pln | |
| Hoffman Fine Chemicals | 200g | 27480.42 Pln | |
| Hoffman Fine Chemicals | 300g | 36993.00 Pln | |
| Hoffman Fine Chemicals | 400g | 44330.00 Pln |
| purity | ≥97-<99% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
2-[(E)-3-chloroprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 153724-93-7) is a chemical compound with the molecular formula C9H16BClO2 and a molecular weight of 202.49 g/mol. IUPAC name: 2-[(E)-3-chloroprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HLBDNUSUVDDICF-AATRIKPKSA-N.
| Molecular formula | C9H16BClO2 |
|---|---|
| Molecular weight | 202.49 g/mol |
| IUPAC name | 2-[(E)-3-chloroprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HLBDNUSUVDDICF-AATRIKPKSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/CCl |
Computed by PubChem (NCBI)