CAS 153724-93-7 appears in our catalog under these names: E-2-Chloromethylvinylboronic acid pinacol ester, 98%, trans-2-Chloromethylvinylboronic acid pinacol ester, 95-<97%, trans-2-Chloromethylvinylboronic acid pinacol ester, ≥97-<99%, 3–Chloropropenyl–1–boronic acid pinacol ester, (E)-2-(3-Chloroprop-1-en-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 95%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Ambeed, Sigma-Aldrich. Available pack sizes: 25g, 5g, 1g, 50g, 100g, 200g, 300g, 400g.
2-[(E)-3-chloroprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 153724-93-7) is a chemical compound with the molecular formula C9H16BClO2 and a molecular weight of 202.49 g/mol. IUPAC name: 2-[(E)-3-chloroprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HLBDNUSUVDDICF-AATRIKPKSA-N.
| Molecular formula | C9H16BClO2 |
|---|---|
| Molecular weight | 202.49 g/mol |
| IUPAC name | 2-[(E)-3-chloroprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HLBDNUSUVDDICF-AATRIKPKSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/CCl |
Computed by PubChem (NCBI)