(E)-3-(2-Bromophenyl)acrylaldehyde, 97%
cas: 138555-58-5 — see every product listed under this CAS number, including other names
(E)-3-(2-Bromophenyl)acrylaldehyde, 97% (CAS 138555-58-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A159932-1g |
| cas | 138555-58-5 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 159.00 Pln | |
| Ambeed | 5g | 320.31 Pln | |
| Ambeed | 10g | 520.56 Pln | |
| Ambeed | 25g | 1043.44 Pln | |
| Ambeed | 100g | 3602.19 Pln | |
| Ambeed | 500g | 14209.88 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 314.36 Pln | |
| BLDpharm | 10g | 508.73 Pln | |
| BLDpharm | 25g | 1025.22 Pln | |
| BLDpharm | 100g | 3535.45 Pln | |
| BLDpharm | 500g | 13926.23 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(E)-3-(2-bromophenyl)prop-2-enal (CAS 138555-58-5) is a chemical compound with the molecular formula C9H7BrO and a molecular weight of 211.05 g/mol. IUPAC name: (E)-3-(2-bromophenyl)prop-2-enal. InChIKey: NIDKLBQFMCVZKV-HWKANZROSA-N.
| Molecular formula | C9H7BrO |
|---|---|
| Molecular weight | 211.05 g/mol |
| IUPAC name | (E)-3-(2-bromophenyl)prop-2-enal |
| InChIKey | NIDKLBQFMCVZKV-HWKANZROSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C/C=O)Br |
Computed by PubChem (NCBI)
