CAS 66223-53-8 is the registry number for 3–(2–Bromophenyl)acrylaldehyde. Offered by: GLPBio. Available pack sizes: 1g, 25g, 5g.
(E)-3-(2-bromophenyl)prop-2-enal (CAS 66223-53-8) is a chemical compound with the molecular formula C9H7BrO and a molecular weight of 211.05 g/mol. IUPAC name: (E)-3-(2-bromophenyl)prop-2-enal. InChIKey: NIDKLBQFMCVZKV-HWKANZROSA-N.
| Molecular formula | C9H7BrO |
|---|---|
| Molecular weight | 211.05 g/mol |
| IUPAC name | (E)-3-(2-bromophenyl)prop-2-enal |
| InChIKey | NIDKLBQFMCVZKV-HWKANZROSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C/C=O)Br |
Computed by PubChem (NCBI)