cas: 18944-77-9 — see every product listed under this CAS number, including other names
(E)-3-(2-Fluorophenyl)Acrylic Acid, 98%, 98% (CAS 18944-77-9) is a chemical reagent available from Chemat. Available pack sizes: 100g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113DOD-100g |
| cas | 18944-77-9 |
| size | 100g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 371.60 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 25g | 146.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(E)-3-(2-fluorophenyl)prop-2-enoic acid (CAS 18944-77-9) is a chemical compound with the molecular formula C9H7FO2 and a molecular weight of 166.15 g/mol. IUPAC name: (E)-3-(2-fluorophenyl)prop-2-enoic acid. InChIKey: IOUDZAFBPDDAMK-AATRIKPKSA-N.
| Molecular formula | C9H7FO2 |
|---|---|
| Molecular weight | 166.15 g/mol |
| IUPAC name | (E)-3-(2-fluorophenyl)prop-2-enoic acid |
| InChIKey | IOUDZAFBPDDAMK-AATRIKPKSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C/C(=O)O)F |
Computed by PubChem (NCBI)