cas: 161395-97-7 — see every product listed under this CAS number, including other names
(E)-3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)allyl acetate, 97%, 97% (CAS 161395-97-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112SEY-250mg |
| cas | 161395-97-7 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 712.40 Pln | |
| Chemat | 5g | 2402.00 Pln | |
| Chemat | 100mg | 208.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] acetate (CAS 161395-97-7) is a chemical compound with the molecular formula C11H19BO4 and a molecular weight of 226.08 g/mol. IUPAC name: [(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] acetate. InChIKey: ZXBRLGZFCXGTBA-VOTSOKGWSA-N.
| Molecular formula | C11H19BO4 |
|---|---|
| Molecular weight | 226.08 g/mol |
| IUPAC name | [(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] acetate |
| InChIKey | ZXBRLGZFCXGTBA-VOTSOKGWSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/COC(=O)C |
Computed by PubChem (NCBI)