cas: 78089-99-3 — see every product listed under this CAS number, including other names
(E)-3-(Dimethylamino)-1-(4-nitrophenyl)prop-2-en-1-one 98% (CAS 78089-99-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A607317-10g |
| cas | 78089-99-3 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 1199.19 Pln | |
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 776.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A607317 |
(E)-3-(dimethylamino)-1-(4-nitrophenyl)prop-2-en-1-one (CAS 78089-99-3) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: (E)-3-(dimethylamino)-1-(4-nitrophenyl)prop-2-en-1-one. InChIKey: LIOPOMJNIUNMRH-BQYQJAHWSA-N.
| Molecular formula | C11H12N2O3 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | (E)-3-(dimethylamino)-1-(4-nitrophenyl)prop-2-en-1-one |
| InChIKey | LIOPOMJNIUNMRH-BQYQJAHWSA-N |
| SMILES | CN(C)/C=C/C(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)