CAS 95545-02-1 appears in our catalog under these names: 1-(2-Methyl-5-nitroindolin-1-yl)ethanone, 97%, 1-Acetyl-2-methyl-5-nitroindoline, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 1g.
1-(2-methyl-5-nitro-2,3-dihydroindol-1-yl)ethanone (CAS 95545-02-1) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: 1-(2-methyl-5-nitro-2,3-dihydroindol-1-yl)ethanone. InChIKey: FNGVDDLTALTXPK-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O3 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 1-(2-methyl-5-nitro-2,3-dihydroindol-1-yl)ethanone |
| InChIKey | FNGVDDLTALTXPK-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(N1C(=O)C)C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)