cas: 117924-31-9 — see every product listed under this CAS number, including other names
(E)-4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-2-ol 97% (CAS 117924-31-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1153865-100mg |
| cas | 117924-31-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 264.69 Pln | |
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 704.12 Pln | |
| Ambeed | 5g | 2361.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1153865 |
(E)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-2-ol (CAS 117924-31-9) is a chemical compound with the molecular formula C10H19BO3 and a molecular weight of 198.07 g/mol. IUPAC name: (E)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-2-ol. InChIKey: FTMZSELHFLRJHW-VOTSOKGWSA-N.
| Molecular formula | C10H19BO3 |
|---|---|
| Molecular weight | 198.07 g/mol |
| IUPAC name | (E)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-2-ol |
| InChIKey | FTMZSELHFLRJHW-VOTSOKGWSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/C(C)O |
Computed by PubChem (NCBI)