CAS 165059-42-7 appears in our catalog under these names: (E)-3-Methoxy-1-propen-1-ylboronic acid, pinacol ester, 98%, (E)-2-(3-Methoxyprop-1-en-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98% mix TBC as stabilizer, (E)-3-Methoxy-1-propen-1-ylboronic acid, pinacol ester, 98%(stabilized with TBC), 98%(stabilized with TBC), (E)-2-(3-Methoxyprop-1-en-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 100mg, 250mg.
2-[(E)-3-methoxyprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 165059-42-7) is a chemical compound with the molecular formula C10H19BO3 and a molecular weight of 198.07 g/mol. IUPAC name: 2-[(E)-3-methoxyprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: FBAOFKFCKHJXRU-VOTSOKGWSA-N.
| Molecular formula | C10H19BO3 |
|---|---|
| Molecular weight | 198.07 g/mol |
| IUPAC name | 2-[(E)-3-methoxyprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | FBAOFKFCKHJXRU-VOTSOKGWSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/COC |
Computed by PubChem (NCBI)