CAS 219489-07-3 appears in our catalog under these names: (Z)-1-Ethoxyethene-2-boronic acid pinacol ester, 97%, (Z)-2-(2-Ethoxyvinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 90% mix TBC as stabilizer, (Z)-2-(2-Ethoxyvinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 90% mix TBC as stabilizer, 90% mix TBC as stabilizer, (Z)-2-(2-Ethoxyvinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 90%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 25g, 5g, 1g, 100mg.
2-[(Z)-2-ethoxyethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 219489-07-3) is a chemical compound with the molecular formula C10H19BO3 and a molecular weight of 198.07 g/mol. IUPAC name: 2-[(Z)-2-ethoxyethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: MRAYNLYCQPAZJN-FPLPWBNLSA-N.
| Molecular formula | C10H19BO3 |
|---|---|
| Molecular weight | 198.07 g/mol |
| IUPAC name | 2-[(Z)-2-ethoxyethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | MRAYNLYCQPAZJN-FPLPWBNLSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C\OCC |
Computed by PubChem (NCBI)