cas: 113467-97-3 — see every product listed under this CAS number, including other names
(E)-4-(Cyclohexylamino)-4-oxobut-2-enoic acid, 98+% (CAS 113467-97-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A2442895-5g |
| cas | 113467-97-3 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 5974.57 Pln | |
| AmBeed | 100mg | 642.88 Pln | |
| AmBeed | 10g | 8838.97 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
(E)-4-(cyclohexylamino)-4-oxobut-2-enoic acid (CAS 113467-97-3) is a chemical compound with the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. IUPAC name: (E)-4-(cyclohexylamino)-4-oxobut-2-enoic acid. InChIKey: DEWAGGNAHQGYBD-VOTSOKGWSA-N.
| Molecular formula | C10H15NO3 |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | (E)-4-(cyclohexylamino)-4-oxobut-2-enoic acid |
| InChIKey | DEWAGGNAHQGYBD-VOTSOKGWSA-N |
| SMILES | C1CCC(CC1)NC(=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)