Products 1499733-15-1
CAS 1499733-15-1 is the registry number for tert-Butyl 3,5-dimethylisoxazole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
Tert-butyl 3,5-dimethyl-1,2-oxazole-4-carboxylate (CAS 1499733-15-1) is a chemical compound with the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. IUPAC name: tert-butyl 3,5-dimethyl-1,2-oxazole-4-carboxylate. InChIKey: FMUINXLDMBLQAO-UHFFFAOYSA-N.
| Molecular formula | C10H15NO3 |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | tert-butyl 3,5-dimethyl-1,2-oxazole-4-carboxylate |
| InChIKey | FMUINXLDMBLQAO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)