Products 21477-59-8
CAS 21477-59-8 appears in our catalog under these names: (Z)-4-(Cyclohexylamino)-4-oxobut-2-enoic acid, 95%, (Z)–4–(cyclohexylamino)–4–oxobut–2–enoic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 100mg, 250mg.
(Z)-4-(cyclohexylamino)-4-oxobut-2-enoic acid (CAS 21477-59-8) is a chemical compound with the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. IUPAC name: (Z)-4-(cyclohexylamino)-4-oxobut-2-enoic acid. InChIKey: DEWAGGNAHQGYBD-SREVYHEPSA-N.
| Molecular formula | C10H15NO3 |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | (Z)-4-(cyclohexylamino)-4-oxobut-2-enoic acid |
| InChIKey | DEWAGGNAHQGYBD-SREVYHEPSA-N |
| SMILES | C1CCC(CC1)NC(=O)/C=C\C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(2Z)-4-(cyclohexylamino)-4-oxo-2-butenoic acid, (Z)-4-(cyclohexylamino)-4-oxobut-2-enoic acid, N-Cyclohexylmaleamic acid, (2Z)-3-(cyclohexylcarbamoyl)prop-2-enoic acid, (Z)-3-Cyclohexylcarbamoyl-acrylic acid, (Z)-4-(cyclohexylamino)-4-oxo-2-butenoic acid, n-cyclohexyl maleamic acid, N-cyclohexyl maleinamic acid, cid_1551599, DEWAGGNAHQGYBD-SREVYHEPSA-N