cas: 861211-22-5 — see every product listed under this CAS number, including other names
(E)-N'-(5-(4-methoxybenzoyl)thiazol-2-yl)-N,N-dimethylformimidamide, 98% (CAS 861211-22-5) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 50mg, 100mg, 500mg, 1g, 5g, 10g, 250mg. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F553103-10MG |
| cas | 861211-22-5 |
| size | 10mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10mg | 294.71 Pln | |
| Fluorochem | 50mg | 320.74 Pln | |
| Fluorochem | 100mg | 325.94 Pln | |
| Fluorochem | 500mg | 612.30 Pln | |
| Fluorochem | 1g | 830.98 Pln | |
| Fluorochem | 5g | 2356.48 Pln | |
| Fluorochem | 10g | 3553.97 Pln | |
| Chemat | 100mg | 237.20 Pln | |
| Chemat | 250mg | 366.80 Pln | |
| Chemat | 1g | 722.00 Pln | |
| Chemat | 5g | 2046.80 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
N'-[5-(4-methoxybenzoyl)-1,3-thiazol-2-yl]-N,N-dimethylmethanimidamide (CAS 861211-22-5) is a chemical compound with the molecular formula C14H15N3O2S and a molecular weight of 289.35 g/mol. IUPAC name: N'-[5-(4-methoxybenzoyl)-1,3-thiazol-2-yl]-N,N-dimethylmethanimidamide. InChIKey: ISAPSSRLTVHWFS-CXUHLZMHSA-N.
| Molecular formula | C14H15N3O2S |
|---|---|
| Molecular weight | 289.35 g/mol |
| IUPAC name | N'-[5-(4-methoxybenzoyl)-1,3-thiazol-2-yl]-N,N-dimethylmethanimidamide |
| InChIKey | ISAPSSRLTVHWFS-CXUHLZMHSA-N |
| SMILES | CN(C)/C=N/C1=NC=C(S1)C(=O)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)