CAS 453523-36-9 is the registry number for 4-Methyl-N'-(1-(pyridin-3-yl)ethylidene)benzenesulfonohydrazide, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
4-methyl-N-[(E)-1-pyridin-3-ylethylideneamino]benzenesulfonamide (CAS 453523-36-9) is a chemical compound with the molecular formula C14H15N3O2S and a molecular weight of 289.35 g/mol. IUPAC name: 4-methyl-N-[(E)-1-pyridin-3-ylethylideneamino]benzenesulfonamide. InChIKey: BMHGFIKYJPCLKO-FOWTUZBSSA-N.
| Molecular formula | C14H15N3O2S |
|---|---|
| Molecular weight | 289.35 g/mol |
| IUPAC name | 4-methyl-N-[(E)-1-pyridin-3-ylethylideneamino]benzenesulfonamide |
| InChIKey | BMHGFIKYJPCLKO-FOWTUZBSSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C(\C)/C2=CN=CC=C2 |
Computed by PubChem (NCBI)