Products 1017117-60-0

CAS 1017117-60-0 is the registry number for 1-(6-(Thiophen-2-yl)pyridazin-3-yl)piperidine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-(6-thiophen-2-ylpyridazin-3-yl)piperidine-4-carboxylic acid (CAS 1017117-60-0) is a chemical compound with the molecular formula C14H15N3O2S and a molecular weight of 289.35 g/mol. IUPAC name: 1-(6-thiophen-2-ylpyridazin-3-yl)piperidine-4-carboxylic acid. InChIKey: IOMQGUSDJPKDLT-UHFFFAOYSA-N.

Identity
Molecular formulaC14H15N3O2S
Molecular weight289.35 g/mol
IUPAC name1-(6-thiophen-2-ylpyridazin-3-yl)piperidine-4-carboxylic acid
InChIKeyIOMQGUSDJPKDLT-UHFFFAOYSA-N
SMILESC1CN(CCC1C(=O)O)C2=NN=C(C=C2)C3=CC=CS3

Computed by PubChem (NCBI)