CAS 693222-51-4 appears in our catalog under these names: Hymenialdisine Analogue #1, (E/Z)-Chk2-IN-1. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, Get quote.
5-(2-amino-4-hydroxy-1H-imidazol-5-yl)-3,4-dihydro-2H-azepino[3,4-b]indol-1-one (CAS 693222-51-4) is a chemical compound with the molecular formula C15H13N5O2 and a molecular weight of 295.30 g/mol. IUPAC name: 5-(2-amino-4-hydroxy-1H-imidazol-5-yl)-3,4-dihydro-2H-azepino[3,4-b]indol-1-one. InChIKey: RZEPRPGFGRQXDI-UHFFFAOYSA-N.
| Molecular formula | C15H13N5O2 |
|---|---|
| Molecular weight | 295.30 g/mol |
| IUPAC name | 5-(2-amino-4-hydroxy-1H-imidazol-5-yl)-3,4-dihydro-2H-azepino[3,4-b]indol-1-one |
| InChIKey | RZEPRPGFGRQXDI-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=NC3=CC=CC=C3C2=C1C4=C(N=C(N4)N)O |
Computed by PubChem (NCBI)