CAS 591726-26-0 appears in our catalog under these names: (E/Z)-ZINC09659342, (E/Z)–ZINC09659342, (E/Z)-ZINC09659342, 99.71%, (E/Z)-ZINC09659342, 99%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress, Ambeed. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 5 mg.
4-[(4E)-3-methyl-5-oxo-4-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]pyrazol-1-yl]benzoic acid (CAS 591726-26-0) is a chemical compound with the molecular formula C23H15F3N2O4 and a molecular weight of 440.4 g/mol. IUPAC name: 4-[(4E)-3-methyl-5-oxo-4-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]pyrazol-1-yl]benzoic acid. InChIKey: SFVRJPWNVAZKMP-XDHOZWIPSA-N.
| Molecular formula | C23H15F3N2O4 |
|---|---|
| Molecular weight | 440.4 g/mol |
| IUPAC name | 4-[(4E)-3-methyl-5-oxo-4-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]pyrazol-1-yl]benzoic acid |
| InChIKey | SFVRJPWNVAZKMP-XDHOZWIPSA-N |
| SMILES | CC\1=NN(C(=O)/C1=C/C2=CC=C(O2)C3=CC(=CC=C3)C(F)(F)F)C4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)