cas: 699-95-6 — see every product listed under this CAS number, including other names
(Exo,exo)-bicyclo[2.2.1]hept-5-ene-2,3-diyldimethanol 97% (CAS 699-95-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A520523-100mg |
| cas | 699-95-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 448.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A520523 |
[(1S,2S,3R,4R)-3-(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol (CAS 699-95-6) is a chemical compound with the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. IUPAC name: [(1S,2S,3R,4R)-3-(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol. InChIKey: IGHHPVIMEQGKNE-OJOKCITNSA-N.
| Molecular formula | C9H14O2 |
|---|---|
| Molecular weight | 154.21 g/mol |
| IUPAC name | [(1S,2S,3R,4R)-3-(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol |
| InChIKey | IGHHPVIMEQGKNE-OJOKCITNSA-N |
| SMILES | C1[C@@H]2C=C[C@H]1[C@@H]([C@@H]2CO)CO |
Computed by PubChem (NCBI)