cas: 699-95-6 — see every product listed under this CAS number, including other names
(Exo,exo)-bicyclo[2.2.1]hept-5-ene-2,3-diyldimethanol, 97%, 97% (CAS 699-95-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MXV-1g |
| cas | 699-95-6 |
| size | 1g |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 270.80 Pln | |
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 155.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[(1S,2S,3R,4R)-3-(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol (CAS 699-95-6) is a chemical compound with the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. IUPAC name: [(1S,2S,3R,4R)-3-(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol. InChIKey: IGHHPVIMEQGKNE-OJOKCITNSA-N.
| Molecular formula | C9H14O2 |
|---|---|
| Molecular weight | 154.21 g/mol |
| IUPAC name | [(1S,2S,3R,4R)-3-(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol |
| InChIKey | IGHHPVIMEQGKNE-OJOKCITNSA-N |
| SMILES | C1[C@@H]2C=C[C@H]1[C@@H]([C@@H]2CO)CO |
Computed by PubChem (NCBI)