CAS 699-95-6 appears in our catalog under these names: 5-Norbornene-2-exo,3-exo-dimethanol, 97%, rel–(1R,2R,3S,4S)–Bicyclo(2·2·1)hept–5–ene–2,3–diyldimethanol, 5-Norbornene-2-exo,3-exo-dimethanol, 97% , 5-Norbornene-2-exo,3-exo-dimethanol, >97.0%(GC), (Exo,exo)-bicyclo[2.2.1]hept-5-ene-2,3-diyldimethanol, 97%, 97%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Chemat. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg.
[(1S,2S,3R,4R)-3-(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol (CAS 699-95-6) is a chemical compound with the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. IUPAC name: [(1S,2S,3R,4R)-3-(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol. InChIKey: IGHHPVIMEQGKNE-OJOKCITNSA-N.
| Molecular formula | C9H14O2 |
|---|---|
| Molecular weight | 154.21 g/mol |
| IUPAC name | [(1S,2S,3R,4R)-3-(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol |
| InChIKey | IGHHPVIMEQGKNE-OJOKCITNSA-N |
| SMILES | C1[C@@H]2C=C[C@H]1[C@@H]([C@@H]2CO)CO |
Computed by PubChem (NCBI)