CAS 941567-71-1 appears in our catalog under these names: (1R,2S,3R,4S)-Bicyclo[2.2.1]hept-5-ene-2,3-diyldimethanol, 97%, (1R,2S,3R,4S)-Bicyclo[2.2.1]hept-5-ene-2,3-diyldimethanol, 97%, 97%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
[(1R,2S,3R,4S)-3-(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol (CAS 941567-71-1) is a chemical compound with the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. IUPAC name: [(1R,2S,3R,4S)-3-(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol. InChIKey: IGHHPVIMEQGKNE-SPJNRGJMSA-N.
| Molecular formula | C9H14O2 |
|---|---|
| Molecular weight | 154.21 g/mol |
| IUPAC name | [(1R,2S,3R,4S)-3-(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol |
| InChIKey | IGHHPVIMEQGKNE-SPJNRGJMSA-N |
| SMILES | C1[C@@H]2C=C[C@H]1[C@H]([C@H]2CO)CO |
Computed by PubChem (NCBI)