cas: 517905-86-1 — see every product listed under this CAS number, including other names
(R),-3-((((9H-Fluoren-9-yl),methoxy),carbonyl),amino),-3-(2-(trifluoromethyl),phenyl),propanoic acid, 98%, 98% (CAS 517905-86-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D90P-100mg |
| cas | 517905-86-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 400.40 Pln | |
| Chemat | 250mg | 573.20 Pln | |
| Chemat | 1g | 1341.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-(trifluoromethyl)phenyl]propanoic acid (CAS 517905-86-1) is a chemical compound with the molecular formula C25H20F3NO4 and a molecular weight of 455.4 g/mol. IUPAC name: (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-(trifluoromethyl)phenyl]propanoic acid. InChIKey: WUSGYGWDKAFPBR-JOCHJYFZSA-N.
| Molecular formula | C25H20F3NO4 |
|---|---|
| Molecular weight | 455.4 g/mol |
| IUPAC name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | WUSGYGWDKAFPBR-JOCHJYFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC(=O)O)C4=CC=CC=C4C(F)(F)F |
Computed by PubChem (NCBI)